CAS 22913-11-7 is the registry number for Propan-2-yl 4-chlorobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Propan-2-yl 4-chlorobenzoate (CAS 22913-11-7) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: propan-2-yl 4-chlorobenzoate. InChIKey: VOLPFZRDHTWKTD-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | propan-2-yl 4-chlorobenzoate |
| InChIKey | VOLPFZRDHTWKTD-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)