cas: 1055025-27-8 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-5-methylimidazo[1,2-a]pyridine, 98% (CAS 1055025-27-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630034-100MG |
| cas | 1055025-27-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 846.59 Pln | |
| Fluorochem | 250mg | 1382.86 Pln | |
| Fluorochem | 1g | 2715.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-chlorophenyl)-5-methylimidazo[1,2-a]pyridine (CAS 1055025-27-8) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-methylimidazo[1,2-a]pyridine. InChIKey: JLFSJUSWARPDMD-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-methylimidazo[1,2-a]pyridine |
| InChIKey | JLFSJUSWARPDMD-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=NC(=CN12)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)