CAS 43181-78-8 appears in our catalog under these names: 1-Benzyl-2-chloro-1h-benzo[d]imidazole, 95%, 1-Benzyl-2-Chloro-1H-Benzo[D]Imidazole, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-benzyl-2-chlorobenzimidazole (CAS 43181-78-8) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 1-benzyl-2-chlorobenzimidazole. InChIKey: PVLIRTAXXPPHCJ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 1-benzyl-2-chlorobenzimidazole |
| InChIKey | PVLIRTAXXPPHCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N=C2Cl |
Computed by PubChem (NCBI)