cas: 1040281-84-2 — see every product listed under this CAS number, including other names
2-(4-Chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 1040281-84-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A396175-5g |
| cas | 1040281-84-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10902.64 Pln | |
| AmBeed | 10g | 14457.10 Pln | |
| AmBeed | 25g | 25459.00 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1040281-84-2) is a chemical compound with the molecular formula C10H14BClO2S and a molecular weight of 244.55 g/mol. IUPAC name: 2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FQPQQVUHQXLKDP-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO2S |
|---|---|
| Molecular weight | 244.55 g/mol |
| IUPAC name | 2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FQPQQVUHQXLKDP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)Cl |
Computed by PubChem (NCBI)