cas: 1040281-84-2 — see every product listed under this CAS number, including other names
4-Chlorothiophen-2-boronic acid, pinacol ester, 95%, 95% (CAS 1040281-84-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WSY-100mg |
| cas | 1040281-84-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1230.80 Pln | |
| Chemat | 1g | 3592.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1040281-84-2) is a chemical compound with the molecular formula C10H14BClO2S and a molecular weight of 244.55 g/mol. IUPAC name: 2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FQPQQVUHQXLKDP-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO2S |
|---|---|
| Molecular weight | 244.55 g/mol |
| IUPAC name | 2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FQPQQVUHQXLKDP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)Cl |
Computed by PubChem (NCBI)