cas: 820223-94-7 — see every product listed under this CAS number, including other names
2-(4-Cyclohexylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 820223-94-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A766514-250mg |
| cas | 820223-94-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 720.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A766514 |
2-(4-cyclohexylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 820223-94-7) is a chemical compound with the molecular formula C18H27BO2 and a molecular weight of 286.2 g/mol. IUPAC name: 2-(4-cyclohexylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: TYHPJCMZSCFGIX-UHFFFAOYSA-N.
| Molecular formula | C18H27BO2 |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | 2-(4-cyclohexylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | TYHPJCMZSCFGIX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCCCC3 |
Computed by PubChem (NCBI)