cas: 815631-56-2 — see every product listed under this CAS number, including other names
2-(4-Fluoro-2-methylphenyl)4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 815631-56-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021832-1G |
| cas | 815631-56-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 1190.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 815631-56-2) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-(4-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HHWOQSZBVGPYMH-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-(4-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HHWOQSZBVGPYMH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)C |
Computed by PubChem (NCBI)