cas: 5457-30-7 — see every product listed under this CAS number, including other names
2-(4-Iodobutyl)isoindoline-1,3-dione 95% (CAS 5457-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1161436-100mg |
| cas | 5457-30-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2311.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1161436 |
2-(4-iodobutyl)isoindole-1,3-dione (CAS 5457-30-7) is a chemical compound with the molecular formula C12H12INO2 and a molecular weight of 329.13 g/mol. IUPAC name: 2-(4-iodobutyl)isoindole-1,3-dione. InChIKey: RDVFAHFZNOEVLZ-UHFFFAOYSA-N.
| Molecular formula | C12H12INO2 |
|---|---|
| Molecular weight | 329.13 g/mol |
| IUPAC name | 2-(4-iodobutyl)isoindole-1,3-dione |
| InChIKey | RDVFAHFZNOEVLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCI |
Computed by PubChem (NCBI)