CAS 5457-30-7 appears in our catalog under these names: 2-(4-Iodo-butyl)-isoindole-1,3-dione, 95%, 2-(4-Iodobutyl)isoindoline-1,3-dione 95%, 2-(4-Iodobutyl)-1H-isoindole-1,3(2H)-dione, 95%, 95%, 2-(4-Iodobutyl)isoindoline-1,3-dione, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
2-(4-iodobutyl)isoindole-1,3-dione (CAS 5457-30-7) is a chemical compound with the molecular formula C12H12INO2 and a molecular weight of 329.13 g/mol. IUPAC name: 2-(4-iodobutyl)isoindole-1,3-dione. InChIKey: RDVFAHFZNOEVLZ-UHFFFAOYSA-N.
| Molecular formula | C12H12INO2 |
|---|---|
| Molecular weight | 329.13 g/mol |
| IUPAC name | 2-(4-iodobutyl)isoindole-1,3-dione |
| InChIKey | RDVFAHFZNOEVLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCI |
Computed by PubChem (NCBI)