cas: 932841-29-7 — see every product listed under this CAS number, including other names
2-(4-Isobutylphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 97% (CAS 932841-29-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A504405-10g |
| cas | 932841-29-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 9210.04 Pln | |
| AmBeed | 5g | 5401.69 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6,8-dimethyl-2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid (CAS 932841-29-7) is a chemical compound with the molecular formula C22H23NO2 and a molecular weight of 333.4 g/mol. IUPAC name: 6,8-dimethyl-2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid. InChIKey: MXTUESDPDNFWPY-UHFFFAOYSA-N.
| Molecular formula | C22H23NO2 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 6,8-dimethyl-2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid |
| InChIKey | MXTUESDPDNFWPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)CC(C)C)C(=O)O)C |
Computed by PubChem (NCBI)