Products 932841-29-7
CAS 932841-29-7 appears in our catalog under these names: 2-(4-Isobutylphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 95%, 2-(4-Isobutylphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
6,8-dimethyl-2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid (CAS 932841-29-7) is a chemical compound with the molecular formula C22H23NO2 and a molecular weight of 333.4 g/mol. IUPAC name: 6,8-dimethyl-2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid. InChIKey: MXTUESDPDNFWPY-UHFFFAOYSA-N.
| Molecular formula | C22H23NO2 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 6,8-dimethyl-2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid |
| InChIKey | MXTUESDPDNFWPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)CC(C)C)C(=O)O)C |
Computed by PubChem (NCBI)