cas: 1591906-87-4 — see every product listed under this CAS number, including other names
2-(4-Isopropylcyclohex-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 1591906-87-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A656808-250mg |
| cas | 1591906-87-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1510.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A656808 |
4,4,5,5-tetramethyl-2-(4-propan-2-ylcyclohexen-1-yl)-1,3,2-dioxaborolane (CAS 1591906-87-4) is a chemical compound with the molecular formula C15H27BO2 and a molecular weight of 250.19 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-propan-2-ylcyclohexen-1-yl)-1,3,2-dioxaborolane. InChIKey: ACYGRPVWJQOCHH-UHFFFAOYSA-N.
| Molecular formula | C15H27BO2 |
|---|---|
| Molecular weight | 250.19 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-propan-2-ylcyclohexen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | ACYGRPVWJQOCHH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)C(C)C |
Computed by PubChem (NCBI)