CAS 2096334-45-9 appears in our catalog under these names: 4-Propylcyclohex-1-enylboronic acid, pinacol ester, 96%, 4,4,5,5-Tetramethyl-2-(4-propylcyclohex-1-en-1-yl)-1,3,2-dioxaborolane 98%, 4-Propylcyclohex-1-enylboronic acid, pinacol ester, 98%, 98%, 4,4,5,5-Tetramethyl-2-(4-propylcyclohex-1-en-1-yl)-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
4,4,5,5-tetramethyl-2-(4-propylcyclohexen-1-yl)-1,3,2-dioxaborolane (CAS 2096334-45-9) is a chemical compound with the molecular formula C15H27BO2 and a molecular weight of 250.19 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-propylcyclohexen-1-yl)-1,3,2-dioxaborolane. InChIKey: AALBRBHEPBSUPZ-UHFFFAOYSA-N.
| Molecular formula | C15H27BO2 |
|---|---|
| Molecular weight | 250.19 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-propylcyclohexen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | AALBRBHEPBSUPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)CCC |
Computed by PubChem (NCBI)