cas: 62966-74-9 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenoxy)-5-(trifluoromethyl)aniline 97% (CAS 62966-74-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A209975-1g |
| cas | 62966-74-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 25g | 1616.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A209975 |
2-(4-methoxyphenoxy)-5-(trifluoromethyl)aniline (CAS 62966-74-9) is a chemical compound with the molecular formula C14H12F3NO2 and a molecular weight of 283.24 g/mol. IUPAC name: 2-(4-methoxyphenoxy)-5-(trifluoromethyl)aniline. InChIKey: PKPSWDNMWOYYEX-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO2 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 2-(4-methoxyphenoxy)-5-(trifluoromethyl)aniline |
| InChIKey | PKPSWDNMWOYYEX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)