cas: 62966-74-9 — see every product listed under this CAS number, including other names
3-Amino-4-(4-methoxyphenoxy)benzotrifluoride, 97%, 97% (CAS 62966-74-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0UR-1g |
| cas | 62966-74-9 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 458.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxyphenoxy)-5-(trifluoromethyl)aniline (CAS 62966-74-9) is a chemical compound with the molecular formula C14H12F3NO2 and a molecular weight of 283.24 g/mol. IUPAC name: 2-(4-methoxyphenoxy)-5-(trifluoromethyl)aniline. InChIKey: PKPSWDNMWOYYEX-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO2 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 2-(4-methoxyphenoxy)-5-(trifluoromethyl)aniline |
| InChIKey | PKPSWDNMWOYYEX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)