cas: 5784-95-2 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)-1H-indole 98% (CAS 5784-95-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A454010-100mg |
| cas | 5784-95-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 2239.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A454010 |
2-(4-methoxyphenyl)-1H-indole (CAS 5784-95-2) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1H-indole. InChIKey: BHCBPEBRFMLOND-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1H-indole |
| InChIKey | BHCBPEBRFMLOND-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)