cas: 5784-95-2 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)-1H-indole (CAS 5784-95-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F495298-250MG |
| cas | 5784-95-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1226.67 Pln | |
| Fluorochem | 5g | 4480.73 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4-methoxyphenyl)-1H-indole (CAS 5784-95-2) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1H-indole. InChIKey: BHCBPEBRFMLOND-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1H-indole |
| InChIKey | BHCBPEBRFMLOND-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)