2-(4-Methoxyphenyl)pyrrolidine hydrochloride, 98%
cas: 1049740-97-7 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)pyrrolidine hydrochloride, 98% (CAS 1049740-97-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A690077-100mg |
| cas | 1049740-97-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 759.75 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 736.40 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 814.18 Pln | |
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 1367.24 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-methoxyphenyl)pyrrolidine;hydrochloride (CAS 1049740-97-7) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 2-(4-methoxyphenyl)pyrrolidine;hydrochloride. InChIKey: SEBSLTSQSAXLOG-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)pyrrolidine;hydrochloride |
| InChIKey | SEBSLTSQSAXLOG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CCCN2.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-methoxyphenyl)pyrrolidine hydrochloride, 2-(4-Methoxy-Phenyl)-Pyrrolidine Hydrochloride, 2-(4-methoxyphenyl)pyrrolidine;hydrochloride, 2-(4-methoxyphenyl)pyrrolidine HCL, Pyrrolidine, 2-(4-methoxyphenyl)-, methyl 4-(2-pyrrolidinyl)phenyl ether, 2-(4-methoxyphenyl)pyrrolidinehydrochloride, 2 - (4 - Methoxy - phenyl) - pyrrolidine, 2-(4-Methoxyphenyl)-pyrrolidine hydrochloride