CAS 105558-52-9 appears in our catalog under these names: 3-Phenyl-3-piperidinol hydrochloride, 95%, 3-Phenylpiperidin-3-ol hydrochloride, 96%, 3-Phenylpiperidin-3-ol hydrochloride, 3-Phenyl-3-piperidinol hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g, 500mg.
3-phenylpiperidin-3-ol;hydrochloride (CAS 105558-52-9) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-phenylpiperidin-3-ol;hydrochloride. InChIKey: OVASVBNMGKOUDN-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-phenylpiperidin-3-ol;hydrochloride |
| InChIKey | OVASVBNMGKOUDN-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)