cas: 42573-57-9 — see every product listed under this CAS number, including other names
2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine, >98.0%(HPLC)(N) (CAS 42573-57-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2140-5G |
| cas | 42573-57-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 319.95 Pln | |
| TCI | 25g | 1003.45 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine (CAS 42573-57-9) is a chemical compound with the molecular formula C14H9Cl6N3O and a molecular weight of 447.9 g/mol. IUPAC name: 2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine. InChIKey: MCNPOZMLKGDJGP-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl6N3O |
|---|---|
| Molecular weight | 447.9 g/mol |
| IUPAC name | 2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| InChIKey | MCNPOZMLKGDJGP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=CC2=NC(=NC(=N2)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)