cas: 42573-57-9 — see every product listed under this CAS number, including other names
2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine (CAS 42573-57-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FOS-1g |
| cas | 42573-57-9 |
| size | 1g |
| availability | 1600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 25g | 530.00 Pln | |
| Chemat | 100g | 1442.00 Pln |
| delivery time | 3 weeks |
|---|
2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine (CAS 42573-57-9) is a chemical compound with the molecular formula C14H9Cl6N3O and a molecular weight of 447.9 g/mol. IUPAC name: 2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine. InChIKey: MCNPOZMLKGDJGP-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl6N3O |
|---|---|
| Molecular weight | 447.9 g/mol |
| IUPAC name | 2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| InChIKey | MCNPOZMLKGDJGP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=CC2=NC(=NC(=N2)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)