cas: 942922-07-8 — see every product listed under this CAS number, including other names
2-(4-Methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 97%, 97% (CAS 942922-07-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EX8-100mg |
| cas | 942922-07-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 909.20 Pln | |
| Chemat | 10g | 1643.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 942922-07-8) is a chemical compound with the molecular formula C15H25BN4O2 and a molecular weight of 304.20 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: LGIDGOSYDQTQDO-UHFFFAOYSA-N.
| Molecular formula | C15H25BN4O2 |
|---|---|
| Molecular weight | 304.20 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | LGIDGOSYDQTQDO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3CCN(CC3)C |
Computed by PubChem (NCBI)