cas: 85803-62-9 — see every product listed under this CAS number, including other names
2-(4-Methylpiperazin-1-yl)benzaldehyde, 98%, 98% (CAS 85803-62-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115XWX-250mg |
| cas | 85803-62-9 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 323.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-methylpiperazin-1-yl)benzaldehyde (CAS 85803-62-9) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)benzaldehyde. InChIKey: GSRYZPWIWYYROI-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)benzaldehyde |
| InChIKey | GSRYZPWIWYYROI-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)