cas: 942-54-1 — see every product listed under this CAS number, including other names
2-(4-methoxyphenyl)propanoic acid, 95%, 95% (CAS 942-54-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHYM-100mg |
| cas | 942-54-1 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 664.40 Pln | |
| Chemat | 5g | 2190.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxyphenyl)propanoic acid (CAS 942-54-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(4-methoxyphenyl)propanoic acid. InChIKey: KBDLTYNZHQRMQC-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)propanoic acid |
| InChIKey | KBDLTYNZHQRMQC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)