cas: 1257431-63-2 — see every product listed under this CAS number, including other names
2-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)propan-2-ol, 95%, 95% (CAS 1257431-63-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OL0-5g |
| cas | 1257431-63-2 |
| size | 5g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 4110.80 Pln | |
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 1g | 1072.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propan-2-ol (CAS 1257431-63-2) is a chemical compound with the molecular formula C14H22BNO3 and a molecular weight of 263.14 g/mol. IUPAC name: 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propan-2-ol. InChIKey: FIWGJYZBBBBXPY-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO3 |
|---|---|
| Molecular weight | 263.14 g/mol |
| IUPAC name | 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propan-2-ol |
| InChIKey | FIWGJYZBBBBXPY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(C)(C)O |
Computed by PubChem (NCBI)