cas: 22424-62-0 — see every product listed under this CAS number, including other names
2-(5-(Benzyloxy)-1H-indol-3-yl)-2-oxoacetamide, 97%, 97% (CAS 22424-62-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117XZK-100mg |
| cas | 22424-62-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1245.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetamide (CAS 22424-62-0) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: 2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetamide. InChIKey: AFVFKZXCLCZAIX-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetamide |
| InChIKey | AFVFKZXCLCZAIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3C(=O)C(=O)N |
Computed by PubChem (NCBI)