2-(5-Chloropent-1-yn-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%
cas: 159087-42-0 — see every product listed under this CAS number, including other names
2-(5-Chloropent-1-yn-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 159087-42-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A447466-250mg |
| cas | 159087-42-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1299.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A447466 |
2-(5-chloropent-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 159087-42-0) is a chemical compound with the molecular formula C11H18BClO2 and a molecular weight of 228.52 g/mol. IUPAC name: 2-(5-chloropent-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QHWSHBYUQAXFBL-UHFFFAOYSA-N.
| Molecular formula | C11H18BClO2 |
|---|---|
| Molecular weight | 228.52 g/mol |
| IUPAC name | 2-(5-chloropent-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QHWSHBYUQAXFBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CCCCCl |
Computed by PubChem (NCBI)
Synonyms:
2-(5-Chloropent-1-yn-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 5-Chloropent-1-ynylboronic acid, pinacol ester, 2-(5-chloropent-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, C11H18BClO2, 2-(5-Chloropent-1-ynyl)-4,4,5,5-tetramethyl-(1,3,2) dioxaborolane, 5-Chloro-1-pentynyl-1-boronic acid pinacol ester, 1,3,2-Dioxaborolane, 2-(5-chloro-1-pentyn-1-yl)-4,4,5,5-tetramethyl-, 2-(5-Chloropent-1-ynyl)boronic acid pinacol ester, 5-Chloropent-1-ynylboronic acid pinacol ester, 5-Chloro-1-pentynyl-1-boronic acid pinacol ester