CAS 159087-42-0 appears in our catalog under these names: 5-Chloropent-1-ynylboronic acid, pinacol ester, 95%, 2-(5-Chloropent-1-yn-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%, 5-Chloropent-1-ynylboronic acid, pinacol ester, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg.
2-(5-chloropent-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 159087-42-0) is a chemical compound with the molecular formula C11H18BClO2 and a molecular weight of 228.52 g/mol. IUPAC name: 2-(5-chloropent-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QHWSHBYUQAXFBL-UHFFFAOYSA-N.
| Molecular formula | C11H18BClO2 |
|---|---|
| Molecular weight | 228.52 g/mol |
| IUPAC name | 2-(5-chloropent-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QHWSHBYUQAXFBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CCCCCl |
Computed by PubChem (NCBI)