cas: 635305-24-7 — see every product listed under this CAS number, including other names
2-(5-Chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 635305-24-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219847-250MG |
| cas | 635305-24-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 471.73 Pln | |
| Fluorochem | 25g | 955.93 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 635305-24-7) is a chemical compound with the molecular formula C10H14BClO2S and a molecular weight of 244.55 g/mol. IUPAC name: 2-(5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DDDRRTOIHWNUSI-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO2S |
|---|---|
| Molecular weight | 244.55 g/mol |
| IUPAC name | 2-(5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DDDRRTOIHWNUSI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)Cl |
Computed by PubChem (NCBI)