cas: 635305-24-7 — see every product listed under this CAS number, including other names
5-CHLOROTHIOPHENE-2-BORONIC ACID PINACOL ESTER, 98%, 98% (CAS 635305-24-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11450B-250mg |
| cas | 635305-24-7 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 616.40 Pln | |
| Chemat | 100g | 1893.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 635305-24-7) is a chemical compound with the molecular formula C10H14BClO2S and a molecular weight of 244.55 g/mol. IUPAC name: 2-(5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DDDRRTOIHWNUSI-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO2S |
|---|---|
| Molecular weight | 244.55 g/mol |
| IUPAC name | 2-(5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DDDRRTOIHWNUSI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)Cl |
Computed by PubChem (NCBI)