cas: 2121512-83-0 — see every product listed under this CAS number, including other names
2-(5-Ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-83-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696655-1G |
| cas | 2121512-83-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1559.89 Pln | |
| Fluorochem | 5g | 4532.80 Pln |
| delivery time | 3-4 weeks |
|---|
2-(5-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-83-0) is a chemical compound with the molecular formula C14H20BFO3 and a molecular weight of 266.12 g/mol. IUPAC name: 2-(5-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QILTUOMFSGYGFI-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO3 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 2-(5-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QILTUOMFSGYGFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OCC)F |
Computed by PubChem (NCBI)