Products 2121512-83-0
CAS 2121512-83-0 appears in our catalog under these names: 5-Ethoxy-2-fluorophenylboronic acid pinacol ester, 97%, 2-(5-Ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
2-(5-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-83-0) is a chemical compound with the molecular formula C14H20BFO3 and a molecular weight of 266.12 g/mol. IUPAC name: 2-(5-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QILTUOMFSGYGFI-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO3 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 2-(5-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QILTUOMFSGYGFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OCC)F |
Computed by PubChem (NCBI)