CAS 101349-12-6 appears in our catalog under these names: 2–(5–fluoro–1H–indol–3–yl)ethan–1–ol, 2-(5-Fluoro-1H-indol-3-yl)ethanol, 98%, 98%, 2-(5-FLUORO-1H-INDOL-3-YL)ETHANOL, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 250mg, 10g.
2-(5-fluoro-1H-indol-3-yl)ethanol (CAS 101349-12-6) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 2-(5-fluoro-1H-indol-3-yl)ethanol. InChIKey: MXTYSYXDDDVPBQ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 2-(5-fluoro-1H-indol-3-yl)ethanol |
| InChIKey | MXTYSYXDDDVPBQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)CCO |
Computed by PubChem (NCBI)