CAS 88229-16-7 appears in our catalog under these names: N-Cyclopropyl 4-fluorobenzamide, 98%, N-Cyclopropyl 4-fluorobenzamide 98%, N-Cyclopropyl 4-fluorobenzamide, 98%, 98%, N-Cyclopropyl-4-fluorobenzamide, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 500g, 5g.
N-cyclopropyl-4-fluorobenzamide (CAS 88229-16-7) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: N-cyclopropyl-4-fluorobenzamide. InChIKey: YPSPTZQFKWMPDX-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | N-cyclopropyl-4-fluorobenzamide |
| InChIKey | YPSPTZQFKWMPDX-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)