cas: 925207-14-3 — see every product listed under this CAS number, including other names
2-(5-Fluoro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95+% (CAS 925207-14-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A599077-250mg |
| cas | 925207-14-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1277.06 Pln | |
| Ambeed | 10g | 2072.50 Pln | |
| Ambeed | 25g | 4075.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A599077 |
2-(5-fluoro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 925207-14-3) is a chemical compound with the molecular formula C12H15BFNO4 and a molecular weight of 267.06 g/mol. IUPAC name: 2-(5-fluoro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JCPLXROABVMFQO-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO4 |
|---|---|
| Molecular weight | 267.06 g/mol |
| IUPAC name | 2-(5-fluoro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JCPLXROABVMFQO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)