CAS 425378-68-3 appears in our catalog under these names: 2–Fluoro–5–nitrophenylboronic acid pinacol ester, 2-(2-Fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(2-Fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-Fluoro-5-nitrophenylboronic acid pinacol ester, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g.
2-(2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 425378-68-3) is a chemical compound with the molecular formula C12H15BFNO4 and a molecular weight of 267.06 g/mol. IUPAC name: 2-(2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FXEVKZIXXGDLFW-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO4 |
|---|---|
| Molecular weight | 267.06 g/mol |
| IUPAC name | 2-(2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FXEVKZIXXGDLFW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)