cas: 205680-84-8 — see every product listed under this CAS number, including other names
2-(5-Hydroxycarbonyl-2-nitrophenyl)malondialdehyde monohydrate (CAS 205680-84-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023393-1G |
| cas | 205680-84-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 10g | 1341.21 Pln | |
| Fluorochem | 25g | 2939.61 Pln |
| delivery time | 2-3 weeks |
|---|
3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid;hydrate (CAS 205680-84-8) is a chemical compound with the molecular formula C10H9NO7 and a molecular weight of 255.18 g/mol. IUPAC name: 3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid;hydrate. InChIKey: SWNCDLAMOWGSKH-UHFFFAOYSA-N.
| Molecular formula | C10H9NO7 |
|---|---|
| Molecular weight | 255.18 g/mol |
| IUPAC name | 3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid;hydrate |
| InChIKey | SWNCDLAMOWGSKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(C=O)C=O)[N+](=O)[O-].O |
Computed by PubChem (NCBI)