CAS 205680-84-8 appears in our catalog under these names: 2-(5-Carboxy-2-nitrophenyl)malondialdehyde monohydrate, 95%, 2-(5-Hydroxycarbonyl-2-nitrophenyl)malondialdehyde monohydrate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid;hydrate (CAS 205680-84-8) is a chemical compound with the molecular formula C10H9NO7 and a molecular weight of 255.18 g/mol. IUPAC name: 3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid;hydrate. InChIKey: SWNCDLAMOWGSKH-UHFFFAOYSA-N.
| Molecular formula | C10H9NO7 |
|---|---|
| Molecular weight | 255.18 g/mol |
| IUPAC name | 3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid;hydrate |
| InChIKey | SWNCDLAMOWGSKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(C=O)C=O)[N+](=O)[O-].O |
Computed by PubChem (NCBI)