cas: 2121513-01-5 — see every product listed under this CAS number, including other names
2-(6-Fluoro-2-methoxy-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥95%, ≥95% (CAS 2121513-01-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K68V-1g |
| cas | 2121513-01-5 |
| size | 1g |
| availability | 13g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2498.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(6-fluoro-2-methoxy-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-01-5) is a chemical compound with the molecular formula C14H20BFO3 and a molecular weight of 266.12 g/mol. IUPAC name: 2-(6-fluoro-2-methoxy-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CUKZFVYOHNZHMX-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO3 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 2-(6-fluoro-2-methoxy-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CUKZFVYOHNZHMX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2OC)C)F |
Computed by PubChem (NCBI)