cas: 97744-77-9 — see every product listed under this CAS number, including other names
2-(6-Oxo-6H-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid, 97%, 97% (CAS 97744-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L2T-100mg |
| cas | 97744-77-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 467.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid (CAS 97744-77-9) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid. InChIKey: PIHRLFGNZWHKIO-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid |
| InChIKey | PIHRLFGNZWHKIO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=CC(=O)O3)CC(=O)O |
Computed by PubChem (NCBI)