cas: 97744-77-9 — see every product listed under this CAS number, including other names
4-Carboxymethyl-6,7-methylenedioxycoumarin, >95.0%(T) (CAS 97744-77-9) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1196-200MG |
| cas | 97744-77-9 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 290.45 Pln | |
| TCI | 1g | 777.26 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid (CAS 97744-77-9) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid. InChIKey: PIHRLFGNZWHKIO-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid |
| InChIKey | PIHRLFGNZWHKIO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=CC(=O)O3)CC(=O)O |
Computed by PubChem (NCBI)