cas: 170893-02-4 — see every product listed under this CAS number, including other names
2-(7-Fluoro-1H-indol-3-yl)acetic acid (CAS 170893-02-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225808-100MG |
| cas | 170893-02-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1643.19 Pln | |
| Fluorochem | 250mg | 2528.29 Pln |
| delivery time | 3-4 weeks |
|---|
2-(7-fluoro-1H-indol-3-yl)acetic acid (CAS 170893-02-4) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: 2-(7-fluoro-1H-indol-3-yl)acetic acid. InChIKey: MXEHCUNCVQVBQL-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 2-(7-fluoro-1H-indol-3-yl)acetic acid |
| InChIKey | MXEHCUNCVQVBQL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)NC=C2CC(=O)O |
Computed by PubChem (NCBI)