Products 1260751-65-2
CAS 1260751-65-2 appears in our catalog under these names: Ethyl 2–cyano–5–fluorobenzoate, Ethyl 2-cyano-5-fluorobenzoate, 95%, Ethyl 2-cyano-5-fluorobenzoate 95+%, 2-Cyano-5-fluorobenzoic acid ethyl ester, Ethyl 2-cyano-5-fluorobenzoate, 95+%, 95+%. Offered by: GLPBio, Combi-blocks, Ambeed, Biosynth, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
Ethyl 2-cyano-5-fluorobenzoate (CAS 1260751-65-2) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: ethyl 2-cyano-5-fluorobenzoate. InChIKey: QMZSRWKQXUGYBE-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | ethyl 2-cyano-5-fluorobenzoate |
| InChIKey | QMZSRWKQXUGYBE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)F)C#N |
Computed by PubChem (NCBI)