cas: 17170-26-2 — see every product listed under this CAS number, including other names
2-(7-Octyn-1-yl)-1H-isoindole-1,3-dione 95% (CAS 17170-26-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A557121-100mg |
| cas | 17170-26-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1699.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A557121 |
2-oct-7-ynylisoindole-1,3-dione (CAS 17170-26-2) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: 2-oct-7-ynylisoindole-1,3-dione. InChIKey: XQFWQWUIBPUXLG-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-oct-7-ynylisoindole-1,3-dione |
| InChIKey | XQFWQWUIBPUXLG-UHFFFAOYSA-N |
| SMILES | C#CCCCCCCN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)