Products 102276-52-8
CAS 102276-52-8 appears in our catalog under these names: Methyl n,n-dibenzylcarbamate, 95%, Methyl dibenzylcarbamate, 97%, Methyl N，N–dibenzylcarbamate, Carbamic acid, bis(phenylmethyl)-, methyl ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25mg.
Methyl N,N-dibenzylcarbamate (CAS 102276-52-8) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: methyl N,N-dibenzylcarbamate. InChIKey: PCTVBWJXLLPNGI-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | methyl N,N-dibenzylcarbamate |
| InChIKey | PCTVBWJXLLPNGI-UHFFFAOYSA-N |
| SMILES | COC(=O)N(CC1=CC=CC=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)