cas: 1820705-12-1 — see every product listed under this CAS number, including other names
2-(Allyloxy)-6-bromo-4-methoxybenzyl Alcohol, >97%, >97% (CAS 1820705-12-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I1XC-100mg |
| cas | 1820705-12-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 755.60 Pln | |
| Chemat | 1g | 1754.00 Pln | |
| Chemat | 5g | 4418.00 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
(2-bromo-4-methoxy-6-prop-2-enoxyphenyl)methanol (CAS 1820705-12-1) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: (2-bromo-4-methoxy-6-prop-2-enoxyphenyl)methanol. InChIKey: ZHJBJLDJODEFIF-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | (2-bromo-4-methoxy-6-prop-2-enoxyphenyl)methanol |
| InChIKey | ZHJBJLDJODEFIF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)CO)OCC=C |
Computed by PubChem (NCBI)