cas: 63547-22-8 — see every product listed under this CAS number, including other names
2-(Benzhydrylthio)acetic acid 97% (CAS 63547-22-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156217-100g |
| cas | 63547-22-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 231.31 Pln | |
| Ambeed | 500g | 759.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156217 |
2-benzhydrylsulfanylacetic acid (CAS 63547-22-8) is a chemical compound with the molecular formula C15H14O2S and a molecular weight of 258.3 g/mol. IUPAC name: 2-benzhydrylsulfanylacetic acid. InChIKey: HTHFEDOFDBZPRX-UHFFFAOYSA-N.
| Molecular formula | C15H14O2S |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 2-benzhydrylsulfanylacetic acid |
| InChIKey | HTHFEDOFDBZPRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)SCC(=O)O |
Computed by PubChem (NCBI)