cas: 63547-22-8 — see every product listed under this CAS number, including other names
2-(Benzhydrylthio)acetic acid, 97%, 97% (CAS 63547-22-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EZ3-5g |
| cas | 63547-22-8 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 100g | 141.20 Pln | |
| Chemat | 500g | 451.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-benzhydrylsulfanylacetic acid (CAS 63547-22-8) is a chemical compound with the molecular formula C15H14O2S and a molecular weight of 258.3 g/mol. IUPAC name: 2-benzhydrylsulfanylacetic acid. InChIKey: HTHFEDOFDBZPRX-UHFFFAOYSA-N.
| Molecular formula | C15H14O2S |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 2-benzhydrylsulfanylacetic acid |
| InChIKey | HTHFEDOFDBZPRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)SCC(=O)O |
Computed by PubChem (NCBI)