cas: 2379322-30-0 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-1-bromo-4-chloro-3-fluorobenzene, 98% (CAS 2379322-30-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1631097-1g |
| cas | 2379322-30-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3370.57 Pln | |
| AmBeed | 10g | 20042.68 Pln | |
| AmBeed | 25g | 39338.32 Pln | |
| AmBeed | 5g | 11833.57 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-bromo-4-chloro-3-fluoro-2-phenylmethoxybenzene (CAS 2379322-30-0) is a chemical compound with the molecular formula C13H9BrClFO and a molecular weight of 315.56 g/mol. IUPAC name: 1-bromo-4-chloro-3-fluoro-2-phenylmethoxybenzene. InChIKey: UYNMQOATZVOKHU-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClFO |
|---|---|
| Molecular weight | 315.56 g/mol |
| IUPAC name | 1-bromo-4-chloro-3-fluoro-2-phenylmethoxybenzene |
| InChIKey | UYNMQOATZVOKHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2F)Cl)Br |
Computed by PubChem (NCBI)