CAS 2140316-53-4 is the registry number for 4-Bromo-2-chloro-1-[(2-fluorophenyl)methoxy]benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-2-chloro-1-[(2-fluorophenyl)methoxy]benzene (CAS 2140316-53-4) is a chemical compound with the molecular formula C13H9BrClFO and a molecular weight of 315.56 g/mol. IUPAC name: 4-bromo-2-chloro-1-[(2-fluorophenyl)methoxy]benzene. InChIKey: SVKOAGYMWYRNGQ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClFO |
|---|---|
| Molecular weight | 315.56 g/mol |
| IUPAC name | 4-bromo-2-chloro-1-[(2-fluorophenyl)methoxy]benzene |
| InChIKey | SVKOAGYMWYRNGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=C(C=C(C=C2)Br)Cl)F |
Computed by PubChem (NCBI)